C17H25N3O4 — CID 11508290
[(3R,4R)-4-amino-1-(3,4-dimethoxyphenyl)piperidin-3-yl]-(1,3-oxazolidin-3-yl)methanone (PubChem CID 11508290) has the molecular formula C17H25N3O4 and a molecular weight of 335.40 g/mol. Its IUPAC name is [(3R,4R)-4-amino-1-(3,4-dimethoxyphenyl)piperidin-3-yl]-(1,3-oxazolidin-3-yl)methanone.
| Compound Name | [(3R,4R)-4-amino-1-(3,4-dimethoxyphenyl)piperidin-3-yl]-(1,3-oxazolidin-3-yl)methanone |
|---|---|
| PubChem CID | 11508290 |
| Molecular Formula | C17H25N3O4 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.18 |
| IUPAC Name | [(3R,4R)-4-amino-1-(3,4-dimethoxyphenyl)piperidin-3-yl]-(1,3-oxazolidin-3-yl)methanone |
| SMILES | COc1ccc(N2CC[C@@H](N)[C@H](C(=O)N3CCOC3)C2)cc1OC |
| InChI | InChI=1S/C17H25N3O4/c1-22-15-4-3-12(9-16(15)23-2)19-6-5-14(18)13(10-19)17(21)20-7-8-24-11-20/h3-4,9,13-14H,5-8,10-11,18H2,1-2H3/t13-,14-/m1/s1 |
| InChIKey | NDXXSIVOWPDXEI-ZIAGYGMSSA-N |
| XLogP | 0.67 |
| TPSA | 77.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|