C21H28N2O2 — CID 45255008
(3S,4R)-1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylphenyl)piperidin-4-amine (PubChem CID 45255008) has the molecular formula C21H28N2O2 and a molecular weight of 340.47 g/mol. Its IUPAC name is (3S,4R)-1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylphenyl)piperidin-4-amine.
| Compound Name | (3S,4R)-1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylphenyl)piperidin-4-amine |
|---|---|
| PubChem CID | 45255008 |
| Molecular Formula | C21H28N2O2 |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | (3S,4R)-1-(3,4-dimethoxyphenyl)-3-(3,4-dimethylphenyl)piperidin-4-amine |
| SMILES | COc1ccc(N2CC[C@@H](N)[C@@H](c3ccc(C)c(C)c3)C2)cc1OC |
| InChI | InChI=1S/C21H28N2O2/c1-14-5-6-16(11-15(14)2)18-13-23(10-9-19(18)22)17-7-8-20(24-3)21(12-17)25-4/h5-8,11-12,18-19H,9-10,13,22H2,1-4H3/t18-,19-/m1/s1 |
| InChIKey | WKWHPPKMVLQTBL-RTBURBONSA-N |
| XLogP | 3.64 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|