C11H10BrNO2 — CID 115087224
2-[2-(2-bromophenyl)-1,3-oxazol-5-yl]ethanol (PubChem CID 115087224) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)-1,3-oxazol-5-yl]ethanol.
| Compound Name | 2-[2-(2-bromophenyl)-1,3-oxazol-5-yl]ethanol |
|---|---|
| PubChem CID | 115087224 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-[2-(2-bromophenyl)-1,3-oxazol-5-yl]ethanol |
| SMILES | OCCc1cnc(-c2ccccc2Br)o1 |
| InChI | InChI=1S/C11H10BrNO2/c12-10-4-2-1-3-9(10)11-13-7-8(15-11)5-6-14/h1-4,7,14H,5-6H2 |
| InChIKey | PSGGBKQCIVEVBS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |