C18H24N4O4 — CID 11508770
N-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxy-1H-indazole-3-carboxamide;formic acid (PubChem CID 11508770) has the molecular formula C18H24N4O4 and a molecular weight of 360.41 g/mol. Its IUPAC name is N-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxy-1H-indazole-3-carboxamide;formic acid.
| Compound Name | N-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxy-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 11508770 |
| Molecular Formula | C18H24N4O4 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | N-(1-azabicyclo[2.2.2]octan-3-ylmethyl)-6-methoxy-1H-indazole-3-carboxamide;formic acid |
| SMILES | COc1ccc2c(C(=O)NCC3CN4CCC3CC4)n[nH]c2c1.O=CO |
| InChI | InChI=1S/C17H22N4O2.CH2O2/c1-23-13-2-3-14-15(8-13)19-20-16(14)17(22)18-9-12-10-21-6-4-11(12)5-7-21;2-1-3/h2-3,8,11-12H,4-7,9-10H2,1H3,(H,18,22)(H,19,20);1H,(H,2,3) |
| InChIKey | QOROCNNFQURAJN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|