C12H11F3N2O — CID 115092939
[5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]methanol (PubChem CID 115092939) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is [5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]methanol.
| Compound Name | [5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]methanol |
|---|---|
| PubChem CID | 115092939 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | [5-[[3-(trifluoromethyl)phenyl]methyl]-1H-pyrazol-3-yl]methanol |
| SMILES | OCc1cc(Cc2cccc(C(F)(F)F)c2)[nH]n1 |
| InChI | InChI=1S/C12H11F3N2O/c13-12(14,15)9-3-1-2-8(4-9)5-10-6-11(7-18)17-16-10/h1-4,6,18H,5,7H2,(H,16,17) |
| InChIKey | ZGUNBJUMMMIZHB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |