C12H13NO3 — CID 115093750
[5-[(4-methoxyphenyl)methyl]-1,2-oxazol-4-yl]methanol (PubChem CID 115093750) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is [5-[(4-methoxyphenyl)methyl]-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-[(4-methoxyphenyl)methyl]-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 115093750 |
| Molecular Formula | C12H13NO3 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.09 |
| IUPAC Name | [5-[(4-methoxyphenyl)methyl]-1,2-oxazol-4-yl]methanol |
| SMILES | COc1ccc(Cc2oncc2CO)cc1 |
| InChI | InChI=1S/C12H13NO3/c1-15-11-4-2-9(3-5-11)6-12-10(8-14)7-13-16-12/h2-5,7,14H,6,8H2,1H3 |
| InChIKey | HOVCPPMAKKVIAP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |