C10H11NO2S — CID 115095787
5-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one (PubChem CID 115095787) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 5-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one.
| Compound Name | 5-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one |
|---|---|
| PubChem CID | 115095787 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one |
| SMILES | CC1Nc2c(CO)cccc2SC1=O |
| InChI | InChI=1S/C10H11NO2S/c1-6-10(13)14-8-4-2-3-7(5-12)9(8)11-6/h2-4,6,11-12H,5H2,1H3 |
| InChIKey | HJXOOGGAIOLLIE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|