C14H21NS — CID 84628238
3-tert-butyl-5-ethyl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 84628238) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is 3-tert-butyl-5-ethyl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | 3-tert-butyl-5-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 84628238 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 3-tert-butyl-5-ethyl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | CCc1cccc2c1NC(C(C)(C)C)CS2 |
| InChI | InChI=1S/C14H21NS/c1-5-10-7-6-8-11-13(10)15-12(9-16-11)14(2,3)4/h6-8,12,15H,5,9H2,1-4H3 |
| InChIKey | FMADXMMDFBUPRU-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |