C11H11NO5S — CID 115096352
3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-6-carboxylic acid (PubChem CID 115096352) has the molecular formula C11H11NO5S and a molecular weight of 269.28 g/mol. Its IUPAC name is 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-6-carboxylic acid.
| Compound Name | 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-6-carboxylic acid |
|---|---|
| PubChem CID | 115096352 |
| Molecular Formula | C11H11NO5S |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.04 |
| IUPAC Name | 3,3-dimethyl-1,1,2-trioxo-4H-1λ6,4-benzothiazine-6-carboxylic acid |
| SMILES | CC1(C)Nc2cc(C(=O)O)ccc2S(=O)(=O)C1=O |
| InChI | InChI=1S/C11H11NO5S/c1-11(2)10(15)18(16,17)8-4-3-6(9(13)14)5-7(8)12-11/h3-5,12H,1-2H3,(H,13,14) |
| InChIKey | FKTRTZJDNLMNRP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|