C20H22F3N3O3 — CID 11509762
3,4-dimethyl-1-[2-oxo-3-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-2,5-dione (PubChem CID 11509762) has the molecular formula C20H22F3N3O3 and a molecular weight of 409.41 g/mol. Its IUPAC name is 3,4-dimethyl-1-[2-oxo-3-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-2,5-dione.
| Compound Name | 3,4-dimethyl-1-[2-oxo-3-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-2,5-dione |
|---|---|
| PubChem CID | 11509762 |
| Molecular Formula | C20H22F3N3O3 |
| Molecular Weight | 409.41 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 3,4-dimethyl-1-[2-oxo-3-[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]propyl]pyrrole-2,5-dione |
| SMILES | CC1=C(C)C(=O)N(CC(=O)CN2CCN(c3ccccc3C(F)(F)F)CC2)C1=O |
| InChI | InChI=1S/C20H22F3N3O3/c1-13-14(2)19(29)26(18(13)28)12-15(27)11-24-7-9-25(10-8-24)17-6-4-3-5-16(17)20(21,22)23/h3-6H,7-12H2,1-2H3 |
| InChIKey | JNCBUBGAPDSSLT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|