C19H19F3N4O — CID 165127998
3-[[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1H-benzimidazol-2-one (PubChem CID 165127998) has the molecular formula C19H19F3N4O and a molecular weight of 376.38 g/mol. Its IUPAC name is 3-[[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1H-benzimidazol-2-one.
| Compound Name | 3-[[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 165127998 |
| Molecular Formula | C19H19F3N4O |
| Molecular Weight | 376.38 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 3-[[4-[2-(trifluoromethyl)phenyl]piperazin-1-yl]methyl]-1H-benzimidazol-2-one |
| SMILES | O=c1[nH]c2ccccc2n1CN1CCN(c2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H19F3N4O/c20-19(21,22)14-5-1-3-7-16(14)25-11-9-24(10-12-25)13-26-17-8-4-2-6-15(17)23-18(26)27/h1-8H,9-13H2,(H,23,27) |
| InChIKey | FXNYPVMTXGPAGA-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |