C15H23N3 — CID 115105241
1-(3-piperazin-1-ylpropyl)-2,3-dihydro-1H-isoindole (PubChem CID 115105241) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 1-(3-piperazin-1-ylpropyl)-2,3-dihydro-1H-isoindole.
| Compound Name | 1-(3-piperazin-1-ylpropyl)-2,3-dihydro-1H-isoindole |
|---|---|
| PubChem CID | 115105241 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 1-(3-piperazin-1-ylpropyl)-2,3-dihydro-1H-isoindole |
| SMILES | c1ccc2c(c1)CNC2CCCN1CCNCC1 |
| InChI | InChI=1S/C15H23N3/c1-2-5-14-13(4-1)12-17-15(14)6-3-9-18-10-7-16-8-11-18/h1-2,4-5,15-17H,3,6-12H2 |
| InChIKey | YPLADHHYLBMAQF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |