C24H24ClN3O4 — CID 11510762
5-chloro-N-[(3R)-3-[(3R,4S)-3,4-dihydroxypyrrolidine-1-carbonyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-2-carboxamide (PubChem CID 11510762) has the molecular formula C24H24ClN3O4 and a molecular weight of 453.93 g/mol. Its IUPAC name is 5-chloro-N-[(3R)-3-[(3R,4S)-3,4-dihydroxypyrrolidine-1-carbonyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[(3R)-3-[(3R,4S)-3,4-dihydroxypyrrolidine-1-carbonyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 11510762 |
| Molecular Formula | C24H24ClN3O4 |
| Molecular Weight | 453.93 g/mol |
| Exact Mass | 453.15 |
| IUPAC Name | 5-chloro-N-[(3R)-3-[(3R,4S)-3,4-dihydroxypyrrolidine-1-carbonyl]-1,2,3,4-tetrahydronaphthalen-2-yl]-1H-indole-2-carboxamide |
| SMILES | O=C(NC1Cc2ccccc2C[C@H]1C(=O)N1C[C@@H](O)[C@@H](O)C1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C24H24ClN3O4/c25-16-5-6-18-15(7-16)10-20(26-18)23(31)27-19-9-14-4-2-1-3-13(14)8-17(19)24(32)28-11-21(29)22(30)12-28/h1-7,10,17,19,21-22,26,29-30H,8-9,11-12H2,(H,27,31)/t17-,19?,21-,22+/m1/s1 |
| InChIKey | WXTZIHYYSLDOIY-VXRQHQKFSA-N |
| XLogP | 1.90 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.93 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |