C13H13BrN4 — CID 115109196
5-(4-bromo-1,2-dimethylindol-3-yl)-1H-pyrazol-4-amine (PubChem CID 115109196) has the molecular formula C13H13BrN4 and a molecular weight of 305.18 g/mol. Its IUPAC name is 5-(4-bromo-1,2-dimethylindol-3-yl)-1H-pyrazol-4-amine.
| Compound Name | 5-(4-bromo-1,2-dimethylindol-3-yl)-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 115109196 |
| Molecular Formula | C13H13BrN4 |
| Molecular Weight | 305.18 g/mol |
| Exact Mass | 304.03 |
| IUPAC Name | 5-(4-bromo-1,2-dimethylindol-3-yl)-1H-pyrazol-4-amine |
| SMILES | Cc1c(-c2[nH]ncc2N)c2c(Br)cccc2n1C |
| InChI | InChI=1S/C13H13BrN4/c1-7-11(13-9(15)6-16-17-13)12-8(14)4-3-5-10(12)18(7)2/h3-6H,15H2,1-2H3,(H,16,17) |
| InChIKey | RKYRLQRNULEABW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 59.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.18 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |