C14H13N3O2 — CID 82299165
5-(1,2-dimethylindol-3-yl)-1H-pyrazole-4-carboxylic acid (PubChem CID 82299165) has the molecular formula C14H13N3O2 and a molecular weight of 255.28 g/mol. Its IUPAC name is 5-(1,2-dimethylindol-3-yl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(1,2-dimethylindol-3-yl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82299165 |
| Molecular Formula | C14H13N3O2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-(1,2-dimethylindol-3-yl)-1H-pyrazole-4-carboxylic acid |
| SMILES | Cc1c(-c2[nH]ncc2C(=O)O)c2ccccc2n1C |
| InChI | InChI=1S/C14H13N3O2/c1-8-12(13-10(14(18)19)7-15-16-13)9-5-3-4-6-11(9)17(8)2/h3-7H,1-2H3,(H,15,16)(H,18,19) |
| InChIKey | ZGXBRSLSSGGQEV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |