C24H25F2N5OS — CID 11511117
7-[3-[[5-(3,4-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-methyl-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine (PubChem CID 11511117) has the molecular formula C24H25F2N5OS and a molecular weight of 469.56 g/mol. Its IUPAC name is 7-[3-[[5-(3,4-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-methyl-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine.
| Compound Name | 7-[3-[[5-(3,4-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-methyl-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 11511117 |
| Molecular Formula | C24H25F2N5OS |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | 7-[3-[[5-(3,4-difluorophenyl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]propyl]-2-methyl-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
| SMILES | Cc1nc2cc3c(cc2o1)CCN(CCCSc1nnc(-c2ccc(F)c(F)c2)n1C)CC3 |
| InChI | InChI=1S/C24H25F2N5OS/c1-15-27-21-13-16-6-9-31(10-7-17(16)14-22(21)32-15)8-3-11-33-24-29-28-23(30(24)2)18-4-5-19(25)20(26)12-18/h4-5,12-14H,3,6-11H2,1-2H3 |
| InChIKey | ZTSFFHIKWHSHGP-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 59.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|