C29H32N6OS — CID 11519134
2-ethyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine (PubChem CID 11519134) has the molecular formula C29H32N6OS and a molecular weight of 512.68 g/mol. Its IUPAC name is 2-ethyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine.
| Compound Name | 2-ethyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
|---|---|
| PubChem CID | 11519134 |
| Molecular Formula | C29H32N6OS |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | 2-ethyl-7-[3-[[4-methyl-5-(2-methylquinolin-5-yl)-1,2,4-triazol-3-yl]sulfanyl]propyl]-5,6,8,9-tetrahydro-[1,3]oxazolo[4,5-h][3]benzazepine |
| SMILES | CCc1nc2cc3c(cc2o1)CCN(CCCSc1nnc(-c2cccc4nc(C)ccc24)n1C)CC3 |
| InChI | InChI=1S/C29H32N6OS/c1-4-27-31-25-17-20-11-14-35(15-12-21(20)18-26(25)36-27)13-6-16-37-29-33-32-28(34(29)3)23-7-5-8-24-22(23)10-9-19(2)30-24/h5,7-10,17-18H,4,6,11-16H2,1-3H3 |
| InChIKey | VURVNYUMSCKMDC-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 72.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|