C15H19ClN4O2 — CID 115112487
tert-butyl N-[5-(5-amino-1-methylpyrazol-4-yl)-2-chlorophenyl]carbamate (PubChem CID 115112487) has the molecular formula C15H19ClN4O2 and a molecular weight of 322.80 g/mol. Its IUPAC name is tert-butyl N-[5-(5-amino-1-methylpyrazol-4-yl)-2-chlorophenyl]carbamate.
| Compound Name | tert-butyl N-[5-(5-amino-1-methylpyrazol-4-yl)-2-chlorophenyl]carbamate |
|---|---|
| PubChem CID | 115112487 |
| Molecular Formula | C15H19ClN4O2 |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | tert-butyl N-[5-(5-amino-1-methylpyrazol-4-yl)-2-chlorophenyl]carbamate |
| SMILES | Cn1ncc(-c2ccc(Cl)c(NC(=O)OC(C)(C)C)c2)c1N |
| InChI | InChI=1S/C15H19ClN4O2/c1-15(2,3)22-14(21)19-12-7-9(5-6-11(12)16)10-8-18-20(4)13(10)17/h5-8H,17H2,1-4H3,(H,19,21) |
| InChIKey | IRUJFYABSRTAAA-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |