C13H22N2 — CID 115113347
2-(3-aminopropyl)-4-ethyl-N,N-dimethylaniline (PubChem CID 115113347) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2-(3-aminopropyl)-4-ethyl-N,N-dimethylaniline.
| Compound Name | 2-(3-aminopropyl)-4-ethyl-N,N-dimethylaniline |
|---|---|
| PubChem CID | 115113347 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2-(3-aminopropyl)-4-ethyl-N,N-dimethylaniline |
| SMILES | CCc1ccc(N(C)C)c(CCCN)c1 |
| InChI | InChI=1S/C13H22N2/c1-4-11-7-8-13(15(2)3)12(10-11)6-5-9-14/h7-8,10H,4-6,9,14H2,1-3H3 |
| InChIKey | IACJNVWIXDXPAV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |