C16H26N2O — CID 115117844
2-N-(2-methoxy-3,4,6-trimethylphenyl)cyclohexane-1,2-diamine (PubChem CID 115117844) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-N-(2-methoxy-3,4,6-trimethylphenyl)cyclohexane-1,2-diamine.
| Compound Name | 2-N-(2-methoxy-3,4,6-trimethylphenyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 115117844 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | 2-N-(2-methoxy-3,4,6-trimethylphenyl)cyclohexane-1,2-diamine |
| SMILES | COc1c(C)c(C)cc(C)c1NC1CCCCC1N |
| InChI | InChI=1S/C16H26N2O/c1-10-9-11(2)15(16(19-4)12(10)3)18-14-8-6-5-7-13(14)17/h9,13-14,18H,5-8,17H2,1-4H3 |
| InChIKey | CHRMXXPYDKZNCD-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |