C14H21BrN2 — CID 115118064
2-N-[2-(4-bromophenyl)ethyl]cyclohexane-1,2-diamine (PubChem CID 115118064) has the molecular formula C14H21BrN2 and a molecular weight of 297.24 g/mol. Its IUPAC name is 2-N-[2-(4-bromophenyl)ethyl]cyclohexane-1,2-diamine.
| Compound Name | 2-N-[2-(4-bromophenyl)ethyl]cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 115118064 |
| Molecular Formula | C14H21BrN2 |
| Molecular Weight | 297.24 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 2-N-[2-(4-bromophenyl)ethyl]cyclohexane-1,2-diamine |
| SMILES | NC1CCCCC1NCCc1ccc(Br)cc1 |
| InChI | InChI=1S/C14H21BrN2/c15-12-7-5-11(6-8-12)9-10-17-14-4-2-1-3-13(14)16/h5-8,13-14,17H,1-4,9-10,16H2 |
| InChIKey | SLMWYUNMNGMXBY-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.24 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |