C20H27N2P — CID 155417637
(1R)-2-N-(2-diphenylphosphanylethyl)cyclohexane-1,2-diamine (PubChem CID 155417637) has the molecular formula C20H27N2P and a molecular weight of 326.42 g/mol. Its IUPAC name is (1R)-2-N-(2-diphenylphosphanylethyl)cyclohexane-1,2-diamine.
| Compound Name | (1R)-2-N-(2-diphenylphosphanylethyl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 155417637 |
| Molecular Formula | C20H27N2P |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | (1R)-2-N-(2-diphenylphosphanylethyl)cyclohexane-1,2-diamine |
| SMILES | N[C@@H]1CCCCC1NCCP(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H27N2P/c21-19-13-7-8-14-20(19)22-15-16-23(17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,19-20,22H,7-8,13-16,21H2/t19-,20?/m1/s1 |
| InChIKey | QKJLKDHSPODUJF-FIWHBWSRSA-N |
| XLogP | 2.98 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|