C9H17N3 — CID 54146554
3-[[(1R,2R)-2-aminocyclohexyl]amino]propanenitrile (PubChem CID 54146554) has the molecular formula C9H17N3 and a molecular weight of 167.26 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-aminocyclohexyl]amino]propanenitrile.
| Compound Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]propanenitrile |
|---|---|
| PubChem CID | 54146554 |
| Molecular Formula | C9H17N3 |
| Molecular Weight | 167.26 g/mol |
| Exact Mass | 167.14 |
| IUPAC Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]propanenitrile |
| SMILES | N#CCCN[C@@H]1CCCC[C@H]1N |
| InChI | InChI=1S/C9H17N3/c10-6-3-7-12-9-5-2-1-4-8(9)11/h8-9,12H,1-5,7,11H2/t8-,9-/m1/s1 |
| InChIKey | OEUIIRAAMHTABH-RKDXNWHRSA-N |
| XLogP | 0.76 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|