C26H50O6Si2 — CID 11511880
methyl 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]acetate (PubChem CID 11511880) has the molecular formula C26H50O6Si2 and a molecular weight of 514.85 g/mol. Its IUPAC name is methyl 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]acetate.
| Compound Name | methyl 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]acetate |
|---|---|
| PubChem CID | 11511880 |
| Molecular Formula | C26H50O6Si2 |
| Molecular Weight | 514.85 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | methyl 2-[(3R,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-4-[3-(methoxymethoxy)propylidene]cyclohexylidene]acetate |
| SMILES | COCOCCC=C1[C@H](O[Si](C)(C)C(C)(C)C)CC(=CC(=O)OC)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H50O6Si2/c1-25(2,3)33(9,10)31-22-16-20(18-24(27)29-8)17-23(32-34(11,12)26(4,5)6)21(22)14-13-15-30-19-28-7/h14,18,22-23H,13,15-17,19H2,1-12H3/b20-18-,21-14+/t22-,23-/m1/s1 |
| InChIKey | NQTFEWOCIPKCGC-FGSYSCJISA-N |
| XLogP | 6.60 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.85 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|