C7H12BrN3S — CID 115119369
3-N-(5-bromothiophen-2-yl)propane-1,2,3-triamine (PubChem CID 115119369) has the molecular formula C7H12BrN3S and a molecular weight of 250.16 g/mol. Its IUPAC name is 3-N-(5-bromothiophen-2-yl)propane-1,2,3-triamine.
| Compound Name | 3-N-(5-bromothiophen-2-yl)propane-1,2,3-triamine |
|---|---|
| PubChem CID | 115119369 |
| Molecular Formula | C7H12BrN3S |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 248.99 |
| IUPAC Name | 3-N-(5-bromothiophen-2-yl)propane-1,2,3-triamine |
| SMILES | NCC(N)CNc1ccc(Br)s1 |
| InChI | InChI=1S/C7H12BrN3S/c8-6-1-2-7(12-6)11-4-5(10)3-9/h1-2,5,11H,3-4,9-10H2 |
| InChIKey | JMACGHUOICGZFT-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |