C8H10ClNO3S — CID 115122846
4-[(5-chlorothiophen-2-yl)amino]-3-hydroxybutanoic acid (PubChem CID 115122846) has the molecular formula C8H10ClNO3S and a molecular weight of 235.69 g/mol. Its IUPAC name is 4-[(5-chlorothiophen-2-yl)amino]-3-hydroxybutanoic acid.
| Compound Name | 4-[(5-chlorothiophen-2-yl)amino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 115122846 |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 4-[(5-chlorothiophen-2-yl)amino]-3-hydroxybutanoic acid |
| SMILES | O=C(O)CC(O)CNc1ccc(Cl)s1 |
| InChI | InChI=1S/C8H10ClNO3S/c9-6-1-2-7(14-6)10-4-5(11)3-8(12)13/h1-2,5,10-11H,3-4H2,(H,12,13) |
| InChIKey | DBFRPDPZBUIERT-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |