C14H20N2 — CID 115131382
2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetonitrile (PubChem CID 115131382) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetonitrile.
| Compound Name | 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetonitrile |
|---|---|
| PubChem CID | 115131382 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetonitrile |
| SMILES | Cc1cc(C)c(CCN(C)CC#N)cc1C |
| InChI | InChI=1S/C14H20N2/c1-11-9-13(3)14(10-12(11)2)5-7-16(4)8-6-15/h9-10H,5,7-8H2,1-4H3 |
| InChIKey | ZRVFMJXFSTVEAU-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|