C14H21NO — CID 115223399
2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetaldehyde (PubChem CID 115223399) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetaldehyde.
| Compound Name | 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetaldehyde |
|---|---|
| PubChem CID | 115223399 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 2-[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]acetaldehyde |
| SMILES | Cc1cc(C)c(CCN(C)CC=O)cc1C |
| InChI | InChI=1S/C14H21NO/c1-11-9-13(3)14(10-12(11)2)5-6-15(4)7-8-16/h8-10H,5-7H2,1-4H3 |
| InChIKey | BDEJSNDUMBOUPB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|