C13H21NS — CID 115228428
[methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]methanethiol (PubChem CID 115228428) has the molecular formula C13H21NS and a molecular weight of 223.38 g/mol. Its IUPAC name is [methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]methanethiol.
| Compound Name | [methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]methanethiol |
|---|---|
| PubChem CID | 115228428 |
| Molecular Formula | C13H21NS |
| Molecular Weight | 223.38 g/mol |
| Exact Mass | 223.14 |
| IUPAC Name | [methyl-[2-(2,4,5-trimethylphenyl)ethyl]amino]methanethiol |
| SMILES | Cc1cc(C)c(CCN(C)CS)cc1C |
| InChI | InChI=1S/C13H21NS/c1-10-7-12(3)13(8-11(10)2)5-6-14(4)9-15/h7-8,15H,5-6,9H2,1-4H3 |
| InChIKey | RBRFMIJWRPIWCT-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.38 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|