C14H24N2 — CID 115227354
N,N'-dimethyl-N'-[2-(2,4,5-trimethylphenyl)ethyl]methanediamine (PubChem CID 115227354) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is N,N'-dimethyl-N'-[2-(2,4,5-trimethylphenyl)ethyl]methanediamine.
| Compound Name | N,N'-dimethyl-N'-[2-(2,4,5-trimethylphenyl)ethyl]methanediamine |
|---|---|
| PubChem CID | 115227354 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | N,N'-dimethyl-N'-[2-(2,4,5-trimethylphenyl)ethyl]methanediamine |
| SMILES | CNCN(C)CCc1cc(C)c(C)cc1C |
| InChI | InChI=1S/C14H24N2/c1-11-8-13(3)14(9-12(11)2)6-7-16(5)10-15-4/h8-9,15H,6-7,10H2,1-5H3 |
| InChIKey | QWGAUVMROFAZEX-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|