C6H8O3S — CID 11513796
(3R,4S,5R)-4,5-dimethyl-1,6-dioxa-2-thiaspiro[2.4]heptan-7-one (PubChem CID 11513796) has the molecular formula C6H8O3S and a molecular weight of 160.19 g/mol. Its IUPAC name is (3R,4S,5R)-4,5-dimethyl-1,6-dioxa-2-thiaspiro[2.4]heptan-7-one.
| Compound Name | (3R,4S,5R)-4,5-dimethyl-1,6-dioxa-2-thiaspiro[2.4]heptan-7-one |
|---|---|
| PubChem CID | 11513796 |
| Molecular Formula | C6H8O3S |
| Molecular Weight | 160.19 g/mol |
| Exact Mass | 160.02 |
| IUPAC Name | (3R,4S,5R)-4,5-dimethyl-1,6-dioxa-2-thiaspiro[2.4]heptan-7-one |
| SMILES | C[C@H]1OC(=O)[C@@]2(OS2)[C@H]1C |
| InChI | InChI=1S/C6H8O3S/c1-3-4(2)8-5(7)6(3)9-10-6/h3-4H,1-2H3/t3-,4+,6+/m0/s1 |
| InChIKey | CWXAJWVHGCHWCF-MRKVFDINSA-N |
| XLogP | 0.94 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|