C15H24N2O2 — CID 115145778
N-(2,5-dimethoxyphenyl)-N,5,5-trimethylpyrrolidin-3-amine (PubChem CID 115145778) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-N,5,5-trimethylpyrrolidin-3-amine.
| Compound Name | N-(2,5-dimethoxyphenyl)-N,5,5-trimethylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 115145778 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-N,5,5-trimethylpyrrolidin-3-amine |
| SMILES | COc1ccc(OC)c(N(C)C2CNC(C)(C)C2)c1 |
| InChI | InChI=1S/C15H24N2O2/c1-15(2)9-11(10-16-15)17(3)13-8-12(18-4)6-7-14(13)19-5/h6-8,11,16H,9-10H2,1-5H3 |
| InChIKey | GOFJPVLPOBBKBW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |