C10H17N3O — CID 115158043
2-(ethylamino)-N-[2-(1H-pyrrol-3-yl)ethyl]acetamide (PubChem CID 115158043) has the molecular formula C10H17N3O and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-(ethylamino)-N-[2-(1H-pyrrol-3-yl)ethyl]acetamide.
| Compound Name | 2-(ethylamino)-N-[2-(1H-pyrrol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 115158043 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | 2-(ethylamino)-N-[2-(1H-pyrrol-3-yl)ethyl]acetamide |
| SMILES | CCNCC(=O)NCCc1cc[nH]c1 |
| InChI | InChI=1S/C10H17N3O/c1-2-11-8-10(14)13-6-4-9-3-5-12-7-9/h3,5,7,11-12H,2,4,6,8H2,1H3,(H,13,14) |
| InChIKey | MFCWHIUZWCYYIL-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 56.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |