C9H13ClN2O — CID 115162634
3-chloro-N-[2-(1H-pyrrol-3-yl)ethyl]propanamide (PubChem CID 115162634) has the molecular formula C9H13ClN2O and a molecular weight of 200.67 g/mol. Its IUPAC name is 3-chloro-N-[2-(1H-pyrrol-3-yl)ethyl]propanamide.
| Compound Name | 3-chloro-N-[2-(1H-pyrrol-3-yl)ethyl]propanamide |
|---|---|
| PubChem CID | 115162634 |
| Molecular Formula | C9H13ClN2O |
| Molecular Weight | 200.67 g/mol |
| Exact Mass | 200.07 |
| IUPAC Name | 3-chloro-N-[2-(1H-pyrrol-3-yl)ethyl]propanamide |
| SMILES | O=C(CCCl)NCCc1cc[nH]c1 |
| InChI | InChI=1S/C9H13ClN2O/c10-4-1-9(13)12-6-3-8-2-5-11-7-8/h2,5,7,11H,1,3-4,6H2,(H,12,13) |
| InChIKey | RUVDFNXQSBOVHE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.67 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|