C7H9ClN2O — CID 115194921
N-[2-(1H-pyrrol-3-yl)ethyl]carbamoyl chloride (PubChem CID 115194921) has the molecular formula C7H9ClN2O and a molecular weight of 172.62 g/mol. Its IUPAC name is N-[2-(1H-pyrrol-3-yl)ethyl]carbamoyl chloride.
| Compound Name | N-[2-(1H-pyrrol-3-yl)ethyl]carbamoyl chloride |
|---|---|
| PubChem CID | 115194921 |
| Molecular Formula | C7H9ClN2O |
| Molecular Weight | 172.62 g/mol |
| Exact Mass | 172.04 |
| IUPAC Name | N-[2-(1H-pyrrol-3-yl)ethyl]carbamoyl chloride |
| SMILES | O=C(Cl)NCCc1cc[nH]c1 |
| InChI | InChI=1S/C7H9ClN2O/c8-7(11)10-4-2-6-1-3-9-5-6/h1,3,5,9H,2,4H2,(H,10,11) |
| InChIKey | MOQFBNWQAHSXDH-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.62 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|