C7H11N3O — CID 115168515
2-(1H-pyrrol-3-yl)ethylurea (PubChem CID 115168515) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 2-(1H-pyrrol-3-yl)ethylurea.
| Compound Name | 2-(1H-pyrrol-3-yl)ethylurea |
|---|---|
| PubChem CID | 115168515 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 2-(1H-pyrrol-3-yl)ethylurea |
| SMILES | NC(=O)NCCc1cc[nH]c1 |
| InChI | InChI=1S/C7H11N3O/c8-7(11)10-4-2-6-1-3-9-5-6/h1,3,5,9H,2,4H2,(H3,8,10,11) |
| InChIKey | UKLPTROKPSPMIU-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |