C22H23N3O2 — CID 11516040
tert-butyl N-[4-[5-[(E)-2-phenylethenyl]-1H-pyrazol-3-yl]phenyl]carbamate (PubChem CID 11516040) has the molecular formula C22H23N3O2 and a molecular weight of 361.45 g/mol. Its IUPAC name is tert-butyl N-[4-[5-[(E)-2-phenylethenyl]-1H-pyrazol-3-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[4-[5-[(E)-2-phenylethenyl]-1H-pyrazol-3-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 11516040 |
| Molecular Formula | C22H23N3O2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | tert-butyl N-[4-[5-[(E)-2-phenylethenyl]-1H-pyrazol-3-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(-c2cc(/C=C/c3ccccc3)[nH]n2)cc1 |
| InChI | InChI=1S/C22H23N3O2/c1-22(2,3)27-21(26)23-18-13-10-17(11-14-18)20-15-19(24-25-20)12-9-16-7-5-4-6-8-16/h4-15H,1-3H3,(H,23,26)(H,24,25)/b12-9+ |
| InChIKey | XRTGQADYJZPMGM-FMIVXFBMSA-N |
| XLogP | 5.59 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |