C30H42N2O — CID 11517967
(2S,4R,5S,9S,13S,16E,18S)-16-ethylidene-5-(4-methoxyphenyl)-6,9,13-trimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-ene (PubChem CID 11517967) has the molecular formula C30H42N2O and a molecular weight of 446.68 g/mol. Its IUPAC name is (2S,4R,5S,9S,13S,16E,18S)-16-ethylidene-5-(4-methoxyphenyl)-6,9,13-trimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-ene.
| Compound Name | (2S,4R,5S,9S,13S,16E,18S)-16-ethylidene-5-(4-methoxyphenyl)-6,9,13-trimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-ene |
|---|---|
| PubChem CID | 11517967 |
| Molecular Formula | C30H42N2O |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.33 |
| IUPAC Name | (2S,4R,5S,9S,13S,16E,18S)-16-ethylidene-5-(4-methoxyphenyl)-6,9,13-trimethyl-6,7-diazapentacyclo[10.8.0.02,9.04,8.013,18]icos-7-ene |
| SMILES | C/C=C1\CC[C@]2(C)C3CC[C@]4(C)C5=NN(C)[C@H](c6ccc(OC)cc6)[C@H]5C[C@H]4C3CC[C@H]2C1 |
| InChI | InChI=1S/C30H42N2O/c1-6-19-13-15-29(2)21(17-19)9-12-23-25(29)14-16-30(3)26(23)18-24-27(32(4)31-28(24)30)20-7-10-22(33-5)11-8-20/h6-8,10-11,21,23-27H,9,12-18H2,1-5H3/b19-6+/t21-,23?,24+,25?,26-,27+,29-,30-/m0/s1 |
| InChIKey | OTGLWZLJGQKPBS-KEPBAYMLSA-N |
| XLogP | 7.25 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|