C24H32N2O3 — CID 143496751
acetaldehyde;ethane;8-methoxy-3-(4-methoxyphenyl)-2-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole (PubChem CID 143496751) has the molecular formula C24H32N2O3 and a molecular weight of 396.53 g/mol. Its IUPAC name is acetaldehyde;ethane;8-methoxy-3-(4-methoxyphenyl)-2-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole.
| Compound Name | acetaldehyde;ethane;8-methoxy-3-(4-methoxyphenyl)-2-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
|---|---|
| PubChem CID | 143496751 |
| Molecular Formula | C24H32N2O3 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.24 |
| IUPAC Name | acetaldehyde;ethane;8-methoxy-3-(4-methoxyphenyl)-2-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole |
| SMILES | CC.CC=O.COc1ccc(C2C3CCc4ccc(OC)cc4C3=NN2C)cc1 |
| InChI | InChI=1S/C20H22N2O2.C2H4O.C2H6/c1-22-20(14-5-8-15(23-2)9-6-14)17-11-7-13-4-10-16(24-3)12-18(13)19(17)21-22;1-2-3;1-2/h4-6,8-10,12,17,20H,7,11H2,1-3H3;2H,1H3;1-2H3 |
| InChIKey | XMABEFKGBKKKGG-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|