C21H23N3O2S — CID 68668747
methyl (3S,3aR)-8-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate (PubChem CID 68668747) has the molecular formula C21H23N3O2S and a molecular weight of 381.50 g/mol. Its IUPAC name is methyl (3S,3aR)-8-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate.
| Compound Name | methyl (3S,3aR)-8-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
|---|---|
| PubChem CID | 68668747 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | methyl (3S,3aR)-8-methoxy-3-(4-methoxyphenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
| SMILES | [H]/N=C(\SC)N1N=C2c3cc(OC)ccc3CC[C@@H]2[C@H]1c1ccc(OC)cc1 |
| InChI | InChI=1S/C21H23N3O2S/c1-25-15-8-5-14(6-9-15)20-17-11-7-13-4-10-16(26-2)12-18(13)19(17)23-24(20)21(22)27-3/h4-6,8-10,12,17,20,22H,7,11H2,1-3H3/b22-21-/t17-,20+/m0/s1 |
| InChIKey | WSNBKCDQZMUTAH-KEXAECJHSA-N |
| XLogP | 4.32 |
| TPSA | 57.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|