C19H19N3S — CID 3766350
methyl 3-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate (PubChem CID 3766350) has the molecular formula C19H19N3S and a molecular weight of 321.45 g/mol. Its IUPAC name is methyl 3-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate.
| Compound Name | methyl 3-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
|---|---|
| PubChem CID | 3766350 |
| Molecular Formula | C19H19N3S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | methyl 3-phenyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carboximidothioate |
| SMILES | [H]/N=C(\SC)N1N=C2c3ccccc3CCC2C1c1ccccc1 |
| InChI | InChI=1S/C19H19N3S/c1-23-19(20)22-18(14-8-3-2-4-9-14)16-12-11-13-7-5-6-10-15(13)17(16)21-22/h2-10,16,18,20H,11-12H2,1H3/b20-19- |
| InChIKey | IABBATFPHUIFJK-VXPUYCOJSA-N |
| XLogP | 4.31 |
| TPSA | 39.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|