C19H18ClN3S — CID 7195281
(3S,3aS)-3-(2-chlorophenyl)-N-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide (PubChem CID 7195281) has the molecular formula C19H18ClN3S and a molecular weight of 355.89 g/mol. Its IUPAC name is (3S,3aS)-3-(2-chlorophenyl)-N-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide.
| Compound Name | (3S,3aS)-3-(2-chlorophenyl)-N-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
|---|---|
| PubChem CID | 7195281 |
| Molecular Formula | C19H18ClN3S |
| Molecular Weight | 355.89 g/mol |
| Exact Mass | 355.09 |
| IUPAC Name | (3S,3aS)-3-(2-chlorophenyl)-N-methyl-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
| SMILES | CNC(=S)N1N=C2c3ccccc3CC[C@H]2[C@H]1c1ccccc1Cl |
| InChI | InChI=1S/C19H18ClN3S/c1-21-19(24)23-18(14-8-4-5-9-16(14)20)15-11-10-12-6-2-3-7-13(12)17(15)22-23/h2-9,15,18H,10-11H2,1H3,(H,21,24)/t15-,18-/m1/s1 |
| InChIKey | JLXVIIHLNXSRMH-CRAIPNDOSA-N |
| XLogP | 4.17 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.89 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|