C18H16ClN3S — CID 5467467
(3R,3aS)-3-(4-chlorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide (PubChem CID 5467467) has the molecular formula C18H16ClN3S and a molecular weight of 341.87 g/mol. Its IUPAC name is (3R,3aS)-3-(4-chlorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide.
| Compound Name | (3R,3aS)-3-(4-chlorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
|---|---|
| PubChem CID | 5467467 |
| Molecular Formula | C18H16ClN3S |
| Molecular Weight | 341.87 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (3R,3aS)-3-(4-chlorophenyl)-3,3a,4,5-tetrahydrobenzo[g]indazole-2-carbothioamide |
| SMILES | NC(=S)N1N=C2c3ccccc3CC[C@H]2[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3S/c19-13-8-5-12(6-9-13)17-15-10-7-11-3-1-2-4-14(11)16(15)21-22(17)18(20)23/h1-6,8-9,15,17H,7,10H2,(H2,20,23)/t15-,17+/m1/s1 |
| InChIKey | VUUOBSLBXXLNEM-WBVHZDCISA-N |
| XLogP | 3.91 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.87 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|