C21H24N2OS — CID 7221513
2-[(5R,6S)-5-(4-methylsulfanylphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraen-4-yl]ethanol (PubChem CID 7221513) has the molecular formula C21H24N2OS and a molecular weight of 352.50 g/mol. Its IUPAC name is 2-[(5R,6S)-5-(4-methylsulfanylphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraen-4-yl]ethanol.
| Compound Name | 2-[(5R,6S)-5-(4-methylsulfanylphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraen-4-yl]ethanol |
|---|---|
| PubChem CID | 7221513 |
| Molecular Formula | C21H24N2OS |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[(5R,6S)-5-(4-methylsulfanylphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraen-4-yl]ethanol |
| SMILES | CSc1ccc([C@H]2[C@@H]3CCCc4ccccc4C3=NN2CCO)cc1 |
| InChI | InChI=1S/C21H24N2OS/c1-25-17-11-9-16(10-12-17)21-19-8-4-6-15-5-2-3-7-18(15)20(19)22-23(21)13-14-24/h2-3,5,7,9-12,19,21,24H,4,6,8,13-14H2,1H3/t19-,21+/m1/s1 |
| InChIKey | PBLWODZKMXNWDG-CTNGQTDRSA-N |
| XLogP | 4.11 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |