C22H24N2O — CID 7221488
(5R,6S)-4-methyl-5-(4-prop-2-enoxyphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraene (PubChem CID 7221488) has the molecular formula C22H24N2O and a molecular weight of 332.45 g/mol. Its IUPAC name is (5R,6S)-4-methyl-5-(4-prop-2-enoxyphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraene.
| Compound Name | (5R,6S)-4-methyl-5-(4-prop-2-enoxyphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraene |
|---|---|
| PubChem CID | 7221488 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | (5R,6S)-4-methyl-5-(4-prop-2-enoxyphenyl)-3,4-diazatricyclo[8.4.0.02,6]tetradeca-1(14),2,10,12-tetraene |
| SMILES | C=CCOc1ccc([C@H]2[C@@H]3CCCc4ccccc4C3=NN2C)cc1 |
| InChI | InChI=1S/C22H24N2O/c1-3-15-25-18-13-11-17(12-14-18)22-20-10-6-8-16-7-4-5-9-19(16)21(20)23-24(22)2/h3-5,7,9,11-14,20,22H,1,6,8,10,15H2,2H3/t20-,22+/m1/s1 |
| InChIKey | HCTSNRAHSVKAGC-IRLDBZIGSA-N |
| XLogP | 4.59 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|