C21H14Cl2FN5S — CID 11518207
6-[2-(2,4-dichloro-5-fluorophenyl)quinolin-4-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 11518207) has the molecular formula C21H14Cl2FN5S and a molecular weight of 458.35 g/mol. Its IUPAC name is 6-[2-(2,4-dichloro-5-fluorophenyl)quinolin-4-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 6-[2-(2,4-dichloro-5-fluorophenyl)quinolin-4-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 11518207 |
| Molecular Formula | C21H14Cl2FN5S |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | 6-[2-(2,4-dichloro-5-fluorophenyl)quinolin-4-yl]-3-propyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | CCCc1nnc2sc(-c3cc(-c4cc(F)c(Cl)cc4Cl)nc4ccccc34)nn12 |
| InChI | InChI=1S/C21H14Cl2FN5S/c1-2-5-19-26-27-21-29(19)28-20(30-21)12-9-18(25-17-7-4-3-6-11(12)17)13-8-16(24)15(23)10-14(13)22/h3-4,6-10H,2,5H2,1H3 |
| InChIKey | RLZTXZLILIVKHU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|