C27H21N5O2S — CID 16737954
3-[(3,4-dimethoxyphenyl)methyl]-6-(2-phenylquinolin-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole (PubChem CID 16737954) has the molecular formula C27H21N5O2S and a molecular weight of 479.57 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-phenylquinolin-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-phenylquinolin-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 16737954 |
| Molecular Formula | C27H21N5O2S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-6-(2-phenylquinolin-4-yl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole |
| SMILES | COc1ccc(Cc2nnc3sc(-c4cc(-c5ccccc5)nc5ccccc45)nn23)cc1OC |
| InChI | InChI=1S/C27H21N5O2S/c1-33-23-13-12-17(14-24(23)34-2)15-25-29-30-27-32(25)31-26(35-27)20-16-22(18-8-4-3-5-9-18)28-21-11-7-6-10-19(20)21/h3-14,16H,15H2,1-2H3 |
| InChIKey | OSDVBOUEGVSMMQ-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 74.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |