C17H15N5O4S — CID 16737620
4-[3-[(3,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-6-hydroxy-1H-pyridin-2-one (PubChem CID 16737620) has the molecular formula C17H15N5O4S and a molecular weight of 385.41 g/mol. Its IUPAC name is 4-[3-[(3,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-6-hydroxy-1H-pyridin-2-one.
| Compound Name | 4-[3-[(3,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-6-hydroxy-1H-pyridin-2-one |
|---|---|
| PubChem CID | 16737620 |
| Molecular Formula | C17H15N5O4S |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | 4-[3-[(3,4-dimethoxyphenyl)methyl]-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl]-6-hydroxy-1H-pyridin-2-one |
| SMILES | COc1ccc(Cc2nnc3sc(-c4cc(O)[nH]c(=O)c4)nn23)cc1OC |
| InChI | InChI=1S/C17H15N5O4S/c1-25-11-4-3-9(5-12(11)26-2)6-13-19-20-17-22(13)21-16(27-17)10-7-14(23)18-15(24)8-10/h3-5,7-8H,6H2,1-2H3,(H2,18,23,24) |
| InChIKey | KTINSBZOPFNGIZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 114.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |