C29H46O4 — CID 11518220
cis-(1R,3S)-5-[(2E)-2-[3-(6-ethyl-6-hydroxyoct-4-ynoxy)spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol (PubChem CID 11518220) has the molecular formula C29H46O4 and a molecular weight of 458.68 g/mol. Its IUPAC name is cis-(1R,3S)-5-[(2E)-2-[3-(6-ethyl-6-hydroxyoct-4-ynoxy)spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol.
| Compound Name | cis-(1R,3S)-5-[(2E)-2-[3-(6-ethyl-6-hydroxyoct-4-ynoxy)spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11518220 |
| Molecular Formula | C29H46O4 |
| Molecular Weight | 458.68 g/mol |
| Exact Mass | 458.34 |
| IUPAC Name | cis-(1R,3S)-5-[(2E)-2-[3-(6-ethyl-6-hydroxyoct-4-ynoxy)spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol |
| SMILES | CCC(O)(C#CCCCOC1CCC2(CCC/C(=C\C=C3/C[C@@H](O)C[C@@H](O)C3)C2)CC1)CC |
| InChI | InChI=1S/C29H46O4/c1-3-29(32,4-2)15-6-5-7-18-33-27-12-16-28(17-13-27)14-8-9-23(22-28)10-11-24-19-25(30)21-26(31)20-24/h10-11,25-27,30-32H,3-5,7-9,12-14,16-22H2,1-2H3/b23-10+,24-11-/t25-,26+,27?,28?/m0/s1 |
| InChIKey | IUJKWXVHMWAKDT-ZLWUKMDRSA-N |
| XLogP | 5.60 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.68 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|