C30H50O4 — CID 11719840
cis-(1S,3R)-5-[(2E)-2-[3-[(E)-7-ethyl-7-hydroxynon-2-enoxy]spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol (PubChem CID 11719840) has the molecular formula C30H50O4 and a molecular weight of 474.73 g/mol. Its IUPAC name is cis-(1S,3R)-5-[(2E)-2-[3-[(E)-7-ethyl-7-hydroxynon-2-enoxy]spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol.
| Compound Name | cis-(1S,3R)-5-[(2E)-2-[3-[(E)-7-ethyl-7-hydroxynon-2-enoxy]spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 11719840 |
| Molecular Formula | C30H50O4 |
| Molecular Weight | 474.73 g/mol |
| Exact Mass | 474.37 |
| IUPAC Name | cis-(1S,3R)-5-[(2E)-2-[3-[(E)-7-ethyl-7-hydroxynon-2-enoxy]spiro[5.5]undecan-10-ylidene]ethylidene]cyclohexane-1,3-diol |
| SMILES | CCC(O)(CC)CCC/C=C/COC1CCC2(CCC/C(=C\C=C3\C[C@@H](O)C[C@@H](O)C3)C2)CC1 |
| InChI | InChI=1S/C30H50O4/c1-3-30(33,4-2)16-7-5-6-8-19-34-28-13-17-29(18-14-28)15-9-10-24(23-29)11-12-25-20-26(31)22-27(32)21-25/h6,8,11-12,26-28,31-33H,3-5,7,9-10,13-23H2,1-2H3/b8-6+,24-11+,25-12-/t26-,27+,28?,29?/m1/s1 |
| InChIKey | VTAAGKZROVZNAU-ASGZXPJASA-N |
| XLogP | 6.54 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.73 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|